C13H10O7 — CID 141076156
(E)-4-oxo-4-[2-oxo-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxyethoxy]but-2-enoic acid (PubChem CID 141076156) has the molecular formula C13H10O7 and a molecular weight of 278.22 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-oxo-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxyethoxy]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[2-oxo-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxyethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 141076156 |
| Molecular Formula | C13H10O7 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (E)-4-oxo-4-[2-oxo-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxyethoxy]but-2-enoic acid |
| SMILES | O=C=C1C=CC=CC1OC(=O)COC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H10O7/c14-7-9-3-1-2-4-10(9)20-13(18)8-19-12(17)6-5-11(15)16/h1-6,10H,8H2,(H,15,16)/b6-5+ |
| InChIKey | FSEXMOVKCMVBAR-AATRIKPKSA-N |
| XLogP | -0.03 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|