C11H10O3 — CID 141035179
methyl 3-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]prop-2-enoate (PubChem CID 141035179) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 3-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]prop-2-enoate.
| Compound Name | methyl 3-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 141035179 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | methyl 3-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1C=CC=CC1=C=O |
| InChI | InChI=1S/C11H10O3/c1-14-11(13)7-6-9-4-2-3-5-10(9)8-12/h2-7,9H,1H3 |
| InChIKey | IYHYUQAHRHHOPK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|