C13H17NO3 — CID 10561730
methyl (E)-3-[(1S,6S,7R,8R)-3,8-dimethyl-2-oxo-3-azabicyclo[4.2.0]oct-4-en-7-yl]prop-2-enoate (PubChem CID 10561730) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl (E)-3-[(1S,6S,7R,8R)-3,8-dimethyl-2-oxo-3-azabicyclo[4.2.0]oct-4-en-7-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1S,6S,7R,8R)-3,8-dimethyl-2-oxo-3-azabicyclo[4.2.0]oct-4-en-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10561730 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl (E)-3-[(1S,6S,7R,8R)-3,8-dimethyl-2-oxo-3-azabicyclo[4.2.0]oct-4-en-7-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1[C@@H](C)[C@@H]2C(=O)N(C)C=C[C@H]12 |
| InChI | InChI=1S/C13H17NO3/c1-8-9(4-5-11(15)17-3)10-6-7-14(2)13(16)12(8)10/h4-10,12H,1-3H3/b5-4+/t8-,9-,10-,12+/m1/s1 |
| InChIKey | HXJLWCWNGNLKTR-AXMXVKNLSA-N |
| XLogP | 1.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|