C8H7BrN4O2 — CID 141078002
5-[[4-(2-bromoethynyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 141078002) has the molecular formula C8H7BrN4O2 and a molecular weight of 271.07 g/mol. Its IUPAC name is 5-[[4-(2-bromoethynyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[[4-(2-bromoethynyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141078002 |
| Molecular Formula | C8H7BrN4O2 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 5-[[4-(2-bromoethynyl)triazol-1-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(Cn2cc(C#CBr)nn2)O1 |
| InChI | InChI=1S/C8H7BrN4O2/c9-2-1-6-4-13(12-11-6)5-7-3-10-8(14)15-7/h4,7H,3,5H2,(H,10,14) |
| InChIKey | WRUZELBYQOWXDW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|