C23H17N5O3 — CID 141078945
2-[4-[2-(3-ethynylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]-2-oxoacetamide (PubChem CID 141078945) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-[4-[2-(3-ethynylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]-2-oxoacetamide.
| Compound Name | 2-[4-[2-(3-ethynylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 141078945 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[4-[2-(3-ethynylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]-2-oxoacetamide |
| SMILES | C#Cc1cccc(Nc2nc3cc(Oc4ccnc(C(=O)C(N)=O)c4)ccc3n2C)c1 |
| InChI | InChI=1S/C23H17N5O3/c1-3-14-5-4-6-15(11-14)26-23-27-18-12-16(7-8-20(18)28(23)2)31-17-9-10-25-19(13-17)21(29)22(24)30/h1,4-13H,2H3,(H2,24,30)(H,26,27) |
| InChIKey | CSPJILGOPNIDEP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|