C11H16N2O5 — CID 141080022
[2-(3,4-dimethoxy-2-pyridinyl)-1-hydroxypropyl] carbamate (PubChem CID 141080022) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is [2-(3,4-dimethoxy-2-pyridinyl)-1-hydroxypropyl] carbamate.
| Compound Name | [2-(3,4-dimethoxy-2-pyridinyl)-1-hydroxypropyl] carbamate |
|---|---|
| PubChem CID | 141080022 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [2-(3,4-dimethoxy-2-pyridinyl)-1-hydroxypropyl] carbamate |
| SMILES | COc1ccnc(C(C)C(O)OC(N)=O)c1OC |
| InChI | InChI=1S/C11H16N2O5/c1-6(10(14)18-11(12)15)8-9(17-3)7(16-2)4-5-13-8/h4-6,10,14H,1-3H3,(H2,12,15) |
| InChIKey | WYDLBYMSSNRQLT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|