C18H13F3N2O2 — CID 141082757
2-[3-oxo-5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-isoindol-2-yl]acetonitrile (PubChem CID 141082757) has the molecular formula C18H13F3N2O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2-[3-oxo-5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-isoindol-2-yl]acetonitrile.
| Compound Name | 2-[3-oxo-5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-isoindol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 141082757 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[3-oxo-5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-isoindol-2-yl]acetonitrile |
| SMILES | N#CCN1Cc2ccc(OCc3ccc(C(F)(F)F)cc3)cc2C1=O |
| InChI | InChI=1S/C18H13F3N2O2/c19-18(20,21)14-4-1-12(2-5-14)11-25-15-6-3-13-10-23(8-7-22)17(24)16(13)9-15/h1-6,9H,8,10-11H2 |
| InChIKey | LNMFKQLHDTXRCH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|