C18H14N2O7 — CID 14108465
1,2,3,4,7-pentahydroxy-3-methyl-6,11-dioxo-2,4-dihydro-1H-benzo[b]carbazole-5-carbonitrile (PubChem CID 14108465) has the molecular formula C18H14N2O7 and a molecular weight of 370.32 g/mol. Its IUPAC name is 1,2,3,4,7-pentahydroxy-3-methyl-6,11-dioxo-2,4-dihydro-1H-benzo[b]carbazole-5-carbonitrile.
| Compound Name | 1,2,3,4,7-pentahydroxy-3-methyl-6,11-dioxo-2,4-dihydro-1H-benzo[b]carbazole-5-carbonitrile |
|---|---|
| PubChem CID | 14108465 |
| Molecular Formula | C18H14N2O7 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1,2,3,4,7-pentahydroxy-3-methyl-6,11-dioxo-2,4-dihydro-1H-benzo[b]carbazole-5-carbonitrile |
| SMILES | CC1(O)C(O)c2c(c3c(n2C#N)C(=O)c2c(O)cccc2C3=O)C(O)C1O |
| InChI | InChI=1S/C18H14N2O7/c1-18(27)16(25)12-10(15(24)17(18)26)9-11(20(12)5-19)14(23)8-6(13(9)22)3-2-4-7(8)21/h2-4,15-17,21,24-27H,1H3 |
| InChIKey | LYQUPMZLMDZPGD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|