C16H30O2Si2 — CID 141084762
tert-butyl-[tert-butyl-bis(ethenyl)silyl]peroxy-bis(ethenyl)silane (PubChem CID 141084762) has the molecular formula C16H30O2Si2 and a molecular weight of 310.59 g/mol. Its IUPAC name is tert-butyl-[tert-butyl-bis(ethenyl)silyl]peroxy-bis(ethenyl)silane.
| Compound Name | tert-butyl-[tert-butyl-bis(ethenyl)silyl]peroxy-bis(ethenyl)silane |
|---|---|
| PubChem CID | 141084762 |
| Molecular Formula | C16H30O2Si2 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | tert-butyl-[tert-butyl-bis(ethenyl)silyl]peroxy-bis(ethenyl)silane |
| SMILES | C=C[Si](C=C)(OO[Si](C=C)(C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2Si2/c1-11-19(12-2,15(5,6)7)17-18-20(13-3,14-4)16(8,9)10/h11-14H,1-4H2,5-10H3 |
| InChIKey | GQICNAOKFRBMLJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|