C28H54O2Si2 — CID 172997371
tert-butyl-[tert-butyl-(4,4-dimethylpent-2-enyl)-prop-2-enylsilyl]peroxy-(4,4-dimethylpent-2-enyl)-prop-2-enylsilane (PubChem CID 172997371) has the molecular formula C28H54O2Si2 and a molecular weight of 478.91 g/mol. Its IUPAC name is tert-butyl-[tert-butyl-(4,4-dimethylpent-2-enyl)-prop-2-enylsilyl]peroxy-(4,4-dimethylpent-2-enyl)-prop-2-enylsilane.
| Compound Name | tert-butyl-[tert-butyl-(4,4-dimethylpent-2-enyl)-prop-2-enylsilyl]peroxy-(4,4-dimethylpent-2-enyl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 172997371 |
| Molecular Formula | C28H54O2Si2 |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.37 |
| IUPAC Name | tert-butyl-[tert-butyl-(4,4-dimethylpent-2-enyl)-prop-2-enylsilyl]peroxy-(4,4-dimethylpent-2-enyl)-prop-2-enylsilane |
| SMILES | C=CC[Si](CC=CC(C)(C)C)(OO[Si](CC=C)(CC=CC(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H54O2Si2/c1-15-21-31(27(9,10)11,23-17-19-25(3,4)5)29-30-32(22-16-2,28(12,13)14)24-18-20-26(6,7)8/h15-20H,1-2,21-24H2,3-14H3 |
| InChIKey | ZTWUQJOLANFVFE-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|