C12H9BrN2O2S — CID 141087470
N-(4-bromo-2-carbamoylphenyl)thiophene-2-carboxamide (PubChem CID 141087470) has the molecular formula C12H9BrN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is N-(4-bromo-2-carbamoylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(4-bromo-2-carbamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141087470 |
| Molecular Formula | C12H9BrN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | N-(4-bromo-2-carbamoylphenyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1cc(Br)ccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C12H9BrN2O2S/c13-7-3-4-9(8(6-7)11(14)16)15-12(17)10-2-1-5-18-10/h1-6H,(H2,14,16)(H,15,17) |
| InChIKey | JKVHOOWVJKPRRO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |