C15H22BrClO — CID 14108773
9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one (PubChem CID 14108773) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is 9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one.
| Compound Name | 9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one |
|---|---|
| PubChem CID | 14108773 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 9-bromo-10-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one |
| SMILES | CC1=CC(=O)CC(C)(C)C12CCC(C)(Br)C(Cl)C2 |
| InChI | InChI=1S/C15H22BrClO/c1-10-7-11(18)8-13(2,3)15(10)6-5-14(4,16)12(17)9-15/h7,12H,5-6,8-9H2,1-4H3 |
| InChIKey | AOCXQJSHHUIKPB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|