C15H23ClO2 — CID 162935179
(6S,9R,10S)-10-chloro-9-hydroxy-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one (PubChem CID 162935179) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is (6S,9R,10S)-10-chloro-9-hydroxy-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one.
| Compound Name | (6S,9R,10S)-10-chloro-9-hydroxy-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one |
|---|---|
| PubChem CID | 162935179 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (6S,9R,10S)-10-chloro-9-hydroxy-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-one |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]12CC[C@@](C)(O)[C@@H](Cl)C2 |
| InChI | InChI=1S/C15H23ClO2/c1-10-7-11(17)8-13(2,3)15(10)6-5-14(4,18)12(16)9-15/h7,12,18H,5-6,8-9H2,1-4H3/t12-,14+,15+/m0/s1 |
| InChIKey | FFJGHAJGNCTETN-NWANDNLSSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|