About (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one
(1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one (PubChem CID 89213647) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one.
Molecular Properties
| Compound Name | (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one |
| PubChem CID | 89213647 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one |
| SMILES | C=C1C2=CC(=O)CC(C)(C)[C@]23CCC1C3 |
| InChI | InChI=1S/C14H18O/c1-9-10-4-5-14(7-10)12(9)6-11(15)8-13(14,2)3/h6,10H,1,4-5,7-8H2,2-3H3/t10?,14-/m0/s1 |
| InChIKey | WMYOWYQHXCMWSC-SBNLOKMTSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one?
The IUPAC name of (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one (CID 89213647) is (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one.
What is the SMILES notation for (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one?
The canonical SMILES for (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one is C=C1C2=CC(=O)CC(C)(C)[C@]23CCC1C3.
What is the InChIKey of (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one?
The InChIKey is WMYOWYQHXCMWSC-SBNLOKMTSA-N. The full InChI is InChI=1S/C14H18O/c1-9-10-4-5-14(7-10)12(9)6-11(15)8-13(14,2)3/h6,10H,1,4-5,7-8H2,2-3H3/t10?,14-/m0/s1.
What are the key properties of (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one?
(1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one has a molecular weight of 202.30 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-dimethyl-7-methylidenetricyclo[6.2.1.01,6]undec-5-en-4-one is sourced from PubChem (CID 89213647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).