C15H25Br2ClO — CID 76900357
(1R,3S,4S)-4-bromo-1-[(1R,3S)-3-bromo-1,2,2-trimethylcyclopentyl]-3-chloro-4-methylcyclohexan-1-ol (PubChem CID 76900357) has the molecular formula C15H25Br2ClO and a molecular weight of 416.63 g/mol. Its IUPAC name is (1R,3S,4S)-4-bromo-1-[(1R,3S)-3-bromo-1,2,2-trimethylcyclopentyl]-3-chloro-4-methylcyclohexan-1-ol.
| Compound Name | (1R,3S,4S)-4-bromo-1-[(1R,3S)-3-bromo-1,2,2-trimethylcyclopentyl]-3-chloro-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 76900357 |
| Molecular Formula | C15H25Br2ClO |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (1R,3S,4S)-4-bromo-1-[(1R,3S)-3-bromo-1,2,2-trimethylcyclopentyl]-3-chloro-4-methylcyclohexan-1-ol |
| SMILES | CC1(C)[C@@H](Br)CC[C@@]1(C)[C@@]1(O)CC[C@](C)(Br)[C@@H](Cl)C1 |
| InChI | InChI=1S/C15H25Br2ClO/c1-12(2)10(16)5-6-14(12,4)15(19)8-7-13(3,17)11(18)9-15/h10-11,19H,5-9H2,1-4H3/t10-,11-,13-,14+,15+/m0/s1 |
| InChIKey | RITYTGBWLLRFSG-XSXPHNMFSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|