C3H3BrCl2 — CID 592798
1-bromo-1,2-dichlorocyclopropane (PubChem CID 592798) has the molecular formula C3H3BrCl2 and a molecular weight of 189.87 g/mol. Its IUPAC name is 1-bromo-1,2-dichlorocyclopropane.
| Compound Name | 1-bromo-1,2-dichlorocyclopropane |
|---|---|
| PubChem CID | 592798 |
| Molecular Formula | C3H3BrCl2 |
| Molecular Weight | 189.87 g/mol |
| Exact Mass | 187.88 |
| IUPAC Name | 1-bromo-1,2-dichlorocyclopropane |
| SMILES | ClC1CC1(Cl)Br |
| InChI | InChI=1S/C3H3BrCl2/c4-3(6)1-2(3)5/h2H,1H2 |
| InChIKey | XGCVMKNKZIYBRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|