C8H12Cl4 — CID 98153250
(1S,2S,4R,5S)-1,2,4,5-tetrachloro-1-ethylcyclohexane (PubChem CID 98153250) has the molecular formula C8H12Cl4 and a molecular weight of 250.00 g/mol. Its IUPAC name is (1S,2S,4R,5S)-1,2,4,5-tetrachloro-1-ethylcyclohexane.
| Compound Name | (1S,2S,4R,5S)-1,2,4,5-tetrachloro-1-ethylcyclohexane |
|---|---|
| PubChem CID | 98153250 |
| Molecular Formula | C8H12Cl4 |
| Molecular Weight | 250.00 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (1S,2S,4R,5S)-1,2,4,5-tetrachloro-1-ethylcyclohexane |
| SMILES | CC[C@]1(Cl)C[C@H](Cl)[C@H](Cl)C[C@@H]1Cl |
| InChI | InChI=1S/C8H12Cl4/c1-2-8(12)4-6(10)5(9)3-7(8)11/h5-7H,2-4H2,1H3/t5-,6+,7+,8+/m1/s1 |
| InChIKey | CVJLWLAYZAIORM-KVPKETBZSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|