C17H20ClF3N2O2 — CID 141091302
6-chloro-4-(2-oxooctyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one (PubChem CID 141091302) has the molecular formula C17H20ClF3N2O2 and a molecular weight of 376.81 g/mol. Its IUPAC name is 6-chloro-4-(2-oxooctyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one.
| Compound Name | 6-chloro-4-(2-oxooctyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 141091302 |
| Molecular Formula | C17H20ClF3N2O2 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 6-chloro-4-(2-oxooctyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one |
| SMILES | CCCCCCC(=O)CC1(C(F)(F)F)NC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H20ClF3N2O2/c1-2-3-4-5-6-12(24)10-16(17(19,20)21)13-9-11(18)7-8-14(13)22-15(25)23-16/h7-9H,2-6,10H2,1H3,(H2,22,23,25) |
| InChIKey | WHBYHRSWUQYMPT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|