C21H26F3NO — CID 141092287
1-(cyclohexylmethyl)-2-methyl-5-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]pyrrole (PubChem CID 141092287) has the molecular formula C21H26F3NO and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-methyl-5-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]pyrrole.
| Compound Name | 1-(cyclohexylmethyl)-2-methyl-5-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]pyrrole |
|---|---|
| PubChem CID | 141092287 |
| Molecular Formula | C21H26F3NO |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-methyl-5-[2-methyl-4-(2,2,2-trifluoroethoxy)phenyl]pyrrole |
| SMILES | Cc1cc(OCC(F)(F)F)ccc1-c1ccc(C)n1CC1CCCCC1 |
| InChI | InChI=1S/C21H26F3NO/c1-15-12-18(26-14-21(22,23)24)9-10-19(15)20-11-8-16(2)25(20)13-17-6-4-3-5-7-17/h8-12,17H,3-7,13-14H2,1-2H3 |
| InChIKey | GVBNHBCEZVXZPS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|