C14H18F3NO — CID 172674976
2-cyclohexyl-5-(2,2,2-trifluoroethoxy)aniline (PubChem CID 172674976) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-cyclohexyl-5-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 2-cyclohexyl-5-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 172674976 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-cyclohexyl-5-(2,2,2-trifluoroethoxy)aniline |
| SMILES | Nc1cc(OCC(F)(F)F)ccc1C1CCCCC1 |
| InChI | InChI=1S/C14H18F3NO/c15-14(16,17)9-19-11-6-7-12(13(18)8-11)10-4-2-1-3-5-10/h6-8,10H,1-5,9,18H2 |
| InChIKey | IOMRBYMSCSZKBZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|