C22H29F6O2P — CID 150790120
[2,6-dicyclohexyl-3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphane (PubChem CID 150790120) has the molecular formula C22H29F6O2P and a molecular weight of 470.43 g/mol. Its IUPAC name is [2,6-dicyclohexyl-3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphane.
| Compound Name | [2,6-dicyclohexyl-3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphane |
|---|---|
| PubChem CID | 150790120 |
| Molecular Formula | C22H29F6O2P |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [2,6-dicyclohexyl-3,5-bis(2,2,2-trifluoroethoxy)phenyl]phosphane |
| SMILES | FC(F)(F)COc1cc(OCC(F)(F)F)c(C2CCCCC2)c(P)c1C1CCCCC1 |
| InChI | InChI=1S/C22H29F6O2P/c23-21(24,25)12-29-16-11-17(30-13-22(26,27)28)19(15-9-5-2-6-10-15)20(31)18(16)14-7-3-1-4-8-14/h11,14-15H,1-10,12-13,31H2 |
| InChIKey | KDRIIICGXJQIRF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|