C17H29F9O3S2 — CID 141102321
[diethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102321) has the molecular formula C17H29F9O3S2 and a molecular weight of 516.53 g/mol. Its IUPAC name is [diethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [diethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102321 |
| Molecular Formula | C17H29F9O3S2 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [diethyl(nonyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCCCS(CC)(CC)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H29F9O3S2/c1-4-7-8-9-10-11-12-13-30(5-2,6-3)29-31(27,28)17(25,26)15(20,21)14(18,19)16(22,23)24/h4-13H2,1-3H3 |
| InChIKey | LSCBAQGOULQSFE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|