C16H27F9O3S2 — CID 141102532
[diethyl(octyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102532) has the molecular formula C16H27F9O3S2 and a molecular weight of 502.51 g/mol. Its IUPAC name is [diethyl(octyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [diethyl(octyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102532 |
| Molecular Formula | C16H27F9O3S2 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [diethyl(octyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCCS(CC)(CC)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H27F9O3S2/c1-4-7-8-9-10-11-12-29(5-2,6-3)28-30(26,27)16(24,25)14(19,20)13(17,18)15(21,22)23/h4-12H2,1-3H3 |
| InChIKey | WKLYFAQYVZPLMC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|