C14H23F9O3S2 — CID 141102572
(ethyl-heptyl-methyl-λ4-sulfanyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102572) has the molecular formula C14H23F9O3S2 and a molecular weight of 474.45 g/mol. Its IUPAC name is (ethyl-heptyl-methyl-λ4-sulfanyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (ethyl-heptyl-methyl-λ4-sulfanyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102572 |
| Molecular Formula | C14H23F9O3S2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | (ethyl-heptyl-methyl-λ4-sulfanyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCS(C)(CC)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F9O3S2/c1-4-6-7-8-9-10-27(3,5-2)26-28(24,25)14(22,23)12(17,18)11(15,16)13(19,20)21/h4-10H2,1-3H3 |
| InChIKey | FWJZQLAFSOMULV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|