C18H31F9O3S2 — CID 141102611
[decyl(diethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102611) has the molecular formula C18H31F9O3S2 and a molecular weight of 530.56 g/mol. Its IUPAC name is [decyl(diethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [decyl(diethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102611 |
| Molecular Formula | C18H31F9O3S2 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | [decyl(diethyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCCCCS(CC)(CC)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H31F9O3S2/c1-4-7-8-9-10-11-12-13-14-31(5-2,6-3)30-32(28,29)18(26,27)16(21,22)15(19,20)17(23,24)25/h4-14H2,1-3H3 |
| InChIKey | FOIPTYJBNUFQNQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|