C18H15O4P — CID 141102911
5-diphenylphosphanylbenzene-1,2,3,4-tetrol (PubChem CID 141102911) has the molecular formula C18H15O4P and a molecular weight of 326.29 g/mol. Its IUPAC name is 5-diphenylphosphanylbenzene-1,2,3,4-tetrol.
| Compound Name | 5-diphenylphosphanylbenzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 141102911 |
| Molecular Formula | C18H15O4P |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-diphenylphosphanylbenzene-1,2,3,4-tetrol |
| SMILES | Oc1cc(P(c2ccccc2)c2ccccc2)c(O)c(O)c1O |
| InChI | InChI=1S/C18H15O4P/c19-14-11-15(17(21)18(22)16(14)20)23(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,19-22H |
| InChIKey | JVXDSCFWNKYCMT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|