C19H15ClN6 — CID 141103966
2-(4-chlorophenyl)-3-(4-methylphenyl)-5-(tetrazol-1-ylmethyl)pyrazine (PubChem CID 141103966) has the molecular formula C19H15ClN6 and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methylphenyl)-5-(tetrazol-1-ylmethyl)pyrazine.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methylphenyl)-5-(tetrazol-1-ylmethyl)pyrazine |
|---|---|
| PubChem CID | 141103966 |
| Molecular Formula | C19H15ClN6 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methylphenyl)-5-(tetrazol-1-ylmethyl)pyrazine |
| SMILES | Cc1ccc(-c2nc(Cn3cnnn3)cnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15ClN6/c1-13-2-4-15(5-3-13)19-18(14-6-8-16(20)9-7-14)21-10-17(23-19)11-26-12-22-24-25-26/h2-10,12H,11H2,1H3 |
| InChIKey | ZAKPMCHAWKZCQH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |