C8H9N3O3S — CID 141106412
methyl 7H-pyrrolo[2,3-d]pyrimidin-2-ylmethanesulfonate (PubChem CID 141106412) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is methyl 7H-pyrrolo[2,3-d]pyrimidin-2-ylmethanesulfonate.
| Compound Name | methyl 7H-pyrrolo[2,3-d]pyrimidin-2-ylmethanesulfonate |
|---|---|
| PubChem CID | 141106412 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | methyl 7H-pyrrolo[2,3-d]pyrimidin-2-ylmethanesulfonate |
| SMILES | COS(=O)(=O)Cc1ncc2cc[nH]c2n1 |
| InChI | InChI=1S/C8H9N3O3S/c1-14-15(12,13)5-7-10-4-6-2-3-9-8(6)11-7/h2-4H,5H2,1H3,(H,9,10,11) |
| InChIKey | OCGGSVSWXXEXRN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|