C8H10N4 — CID 118207021
N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 118207021) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 118207021 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN(C)c1ncc2cc[nH]c2n1 |
| InChI | InChI=1S/C8H10N4/c1-12(2)8-10-5-6-3-4-9-7(6)11-8/h3-5H,1-2H3,(H,9,10,11) |
| InChIKey | USDJWRTWSSYOFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |