C16H10BrCl3N2 — CID 141108787
5-(bromomethyl)-1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazole (PubChem CID 141108787) has the molecular formula C16H10BrCl3N2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 5-(bromomethyl)-1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazole.
| Compound Name | 5-(bromomethyl)-1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazole |
|---|---|
| PubChem CID | 141108787 |
| Molecular Formula | C16H10BrCl3N2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | 5-(bromomethyl)-1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazole |
| SMILES | Clc1ccc(-n2c(CBr)cnc2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H10BrCl3N2/c17-8-13-9-21-16(14-6-3-11(19)7-15(14)20)22(13)12-4-1-10(18)2-5-12/h1-7,9H,8H2 |
| InChIKey | NNZDFVHZGZURBV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|