C17H10BrCl3N2O — CID 86592993
2-bromo-1-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazol-4-yl]ethanone (PubChem CID 86592993) has the molecular formula C17H10BrCl3N2O and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-bromo-1-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazol-4-yl]ethanone.
| Compound Name | 2-bromo-1-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 86592993 |
| Molecular Formula | C17H10BrCl3N2O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 2-bromo-1-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)imidazol-4-yl]ethanone |
| SMILES | O=C(CBr)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H10BrCl3N2O/c18-8-16(24)15-9-23(12-4-1-10(19)2-5-12)17(22-15)13-6-3-11(20)7-14(13)21/h1-7,9H,8H2 |
| InChIKey | XMRNMJKTEKEVCF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|