C23H17Cl3N4O — CID 163957647
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-methyl-N'-phenylimidazole-4-carbohydrazide (PubChem CID 163957647) has the molecular formula C23H17Cl3N4O and a molecular weight of 471.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-methyl-N'-phenylimidazole-4-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-methyl-N'-phenylimidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 163957647 |
| Molecular Formula | C23H17Cl3N4O |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-methyl-N'-phenylimidazole-4-carbohydrazide |
| SMILES | CN(NC(=O)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C23H17Cl3N4O/c1-29(17-5-3-2-4-6-17)28-23(31)21-14-30(18-10-7-15(24)8-11-18)22(27-21)19-12-9-16(25)13-20(19)26/h2-14H,1H3,(H,28,31) |
| InChIKey | SEUHFEHZFHSSSS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|