C22H14Cl3FN4O2S — CID 11432444
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-(4-fluorophenyl)sulfonylimidazole-4-carboximidamide (PubChem CID 11432444) has the molecular formula C22H14Cl3FN4O2S and a molecular weight of 523.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-(4-fluorophenyl)sulfonylimidazole-4-carboximidamide.
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-(4-fluorophenyl)sulfonylimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 11432444 |
| Molecular Formula | C22H14Cl3FN4O2S |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-N'-(4-fluorophenyl)sulfonylimidazole-4-carboximidamide |
| SMILES | N/C(=N/S(=O)(=O)c1ccc(F)cc1)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H14Cl3FN4O2S/c23-13-1-6-16(7-2-13)30-12-20(28-22(30)18-10-3-14(24)11-19(18)25)21(27)29-33(31,32)17-8-4-15(26)5-9-17/h1-12H,(H2,27,29) |
| InChIKey | RDBCFJBAWGHWHE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|