C12H18N2 — CID 141109299
4,5-dimethyl-3-propan-2-yl-1,2-dihydrobenzimidazole (PubChem CID 141109299) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4,5-dimethyl-3-propan-2-yl-1,2-dihydrobenzimidazole.
| Compound Name | 4,5-dimethyl-3-propan-2-yl-1,2-dihydrobenzimidazole |
|---|---|
| PubChem CID | 141109299 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4,5-dimethyl-3-propan-2-yl-1,2-dihydrobenzimidazole |
| SMILES | Cc1ccc2c(c1C)N(C(C)C)CN2 |
| InChI | InChI=1S/C12H18N2/c1-8(2)14-7-13-11-6-5-9(3)10(4)12(11)14/h5-6,8,13H,7H2,1-4H3 |
| InChIKey | HWBCGFYKKKRMOB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |