C24H28N2O7 — CID 141111719
3-[4-[2-[[3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-5-yl]oxy]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 141111719) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[4-[2-[[3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-5-yl]oxy]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[[3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-5-yl]oxy]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 141111719 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-[4-[2-[[3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-5-yl]oxy]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCOc2ccc3[nH]cc(C[C@H](N)C(=O)O)c3c2)cc1)C(=O)O |
| InChI | InChI=1S/C24H28N2O7/c1-2-31-22(24(29)30)11-15-3-5-17(6-4-15)32-9-10-33-18-7-8-21-19(13-18)16(14-26-21)12-20(25)23(27)28/h3-8,13-14,20,22,26H,2,9-12,25H2,1H3,(H,27,28)(H,29,30)/t20-,22?/m0/s1 |
| InChIKey | PFPJSTBNJSSDFL-AIBWNMTMSA-N |
| XLogP | 2.61 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|