C24H28N2O7 — CID 174519471
2-amino-3-[5-[2-[4-[2-(2-carboxyethoxy)ethyl]phenoxy]ethoxy]-1H-indol-3-yl]propanoic acid (PubChem CID 174519471) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-amino-3-[5-[2-[4-[2-(2-carboxyethoxy)ethyl]phenoxy]ethoxy]-1H-indol-3-yl]propanoic acid.
| Compound Name | 2-amino-3-[5-[2-[4-[2-(2-carboxyethoxy)ethyl]phenoxy]ethoxy]-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 174519471 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-amino-3-[5-[2-[4-[2-(2-carboxyethoxy)ethyl]phenoxy]ethoxy]-1H-indol-3-yl]propanoic acid |
| SMILES | NC(Cc1c[nH]c2ccc(OCCOc3ccc(CCOCCC(=O)O)cc3)cc12)C(=O)O |
| InChI | InChI=1S/C24H28N2O7/c25-21(24(29)30)13-17-15-26-22-6-5-19(14-20(17)22)33-12-11-32-18-3-1-16(2-4-18)7-9-31-10-8-23(27)28/h1-6,14-15,21,26H,7-13,25H2,(H,27,28)(H,29,30) |
| InChIKey | UPFXFJOXMFLPHD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|