1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid

C8H13N2O3P — CID 141112718

IUPAC1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid
SMILESO=P#CCCN1CCNCC1C(=O)O
InChIInChI=1S/C8H13N2O3P/c11-8(12)7-6-9-2-4-10(7)3-1-5-14-13/h7,9H,1-4,6H2,(H,11,12)
InChIKeyIHBUOSLQQPHCKZ-UHFFFAOYSA-N
MW216.18 g/mol
LogP-0.01
Rot. Bonds3

About 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid

1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid (PubChem CID 141112718) has the molecular formula C8H13N2O3P and a molecular weight of 216.18 g/mol. Its IUPAC name is 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid.

Molecular Properties

Compound Name1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid
PubChem CID141112718
Molecular FormulaC8H13N2O3P
Molecular Weight216.18 g/mol
Exact Mass216.07
IUPAC Name1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid
SMILESO=P#CCCN1CCNCC1C(=O)O
InChIInChI=1S/C8H13N2O3P/c11-8(12)7-6-9-2-4-10(7)3-1-5-14-13/h7,9H,1-4,6H2,(H,11,12)
InChIKeyIHBUOSLQQPHCKZ-UHFFFAOYSA-N
XLogP-0.01
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.18
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid?
The IUPAC name of 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid (CID 141112718) is 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid.
What is the SMILES notation for 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid?
The canonical SMILES for 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid is O=P#CCCN1CCNCC1C(=O)O.
What is the InChIKey of 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid?
The InChIKey is IHBUOSLQQPHCKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2O3P/c11-8(12)7-6-9-2-4-10(7)3-1-5-14-13/h7,9H,1-4,6H2,(H,11,12).
What are the key properties of 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid?
1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid has a molecular weight of 216.18 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(oxo-λ5-phosphanylidyne)propyl]piperazine-2-carboxylic acid is sourced from PubChem (CID 141112718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).