C25H34N2O2 — CID 141115060
tert-butyl 1-cyano-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-4H-pyridine-3-carboxylate (PubChem CID 141115060) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is tert-butyl 1-cyano-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-4H-pyridine-3-carboxylate.
| Compound Name | tert-butyl 1-cyano-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 141115060 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | tert-butyl 1-cyano-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-4H-pyridine-3-carboxylate |
| SMILES | CCC1=C(C(=O)OC(C)(C)C)C(c2ccc(C)cc2)C=C(CC(C)(C)C)N1C#N |
| InChI | InChI=1S/C25H34N2O2/c1-9-21-22(23(28)29-25(6,7)8)20(18-12-10-17(2)11-13-18)14-19(27(21)16-26)15-24(3,4)5/h10-14,20H,9,15H2,1-8H3 |
| InChIKey | MAAFLCMHJVSOHG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|