C26H27N3O2 — CID 141117028
3-(4-methoxycyclohexyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazine (PubChem CID 141117028) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(4-methoxycyclohexyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazine.
| Compound Name | 3-(4-methoxycyclohexyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 141117028 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-(4-methoxycyclohexyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazine |
| SMILES | COC1CCC(c2nc(-c3cccc(OCc4ccccc4)c3)c3cnccn23)CC1 |
| InChI | InChI=1S/C26H27N3O2/c1-30-22-12-10-20(11-13-22)26-28-25(24-17-27-14-15-29(24)26)21-8-5-9-23(16-21)31-18-19-6-3-2-4-7-19/h2-9,14-17,20,22H,10-13,18H2,1H3 |
| InChIKey | ZBZJPFDRPPLKCC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |