C16H22F2N2 — CID 141117793
4,4-difluoro-1-(1-phenylpiperidin-2-yl)piperidine (PubChem CID 141117793) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4,4-difluoro-1-(1-phenylpiperidin-2-yl)piperidine.
| Compound Name | 4,4-difluoro-1-(1-phenylpiperidin-2-yl)piperidine |
|---|---|
| PubChem CID | 141117793 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4,4-difluoro-1-(1-phenylpiperidin-2-yl)piperidine |
| SMILES | FC1(F)CCN(C2CCCCN2c2ccccc2)CC1 |
| InChI | InChI=1S/C16H22F2N2/c17-16(18)9-12-19(13-10-16)15-8-4-5-11-20(15)14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-13H2 |
| InChIKey | IDXBSHYEWDAALC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |