C20H22ClN3O3S — CID 141117901
4-(3-chlorobenzoyl)-N-[(1R,2S)-2-phenylcyclopropyl]piperazine-1-sulfonamide (PubChem CID 141117901) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 4-(3-chlorobenzoyl)-N-[(1R,2S)-2-phenylcyclopropyl]piperazine-1-sulfonamide.
| Compound Name | 4-(3-chlorobenzoyl)-N-[(1R,2S)-2-phenylcyclopropyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 141117901 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-(3-chlorobenzoyl)-N-[(1R,2S)-2-phenylcyclopropyl]piperazine-1-sulfonamide |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(S(=O)(=O)N[C@@H]2C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O3S/c21-17-8-4-7-16(13-17)20(25)23-9-11-24(12-10-23)28(26,27)22-19-14-18(19)15-5-2-1-3-6-15/h1-8,13,18-19,22H,9-12,14H2/t18-,19+/m0/s1 |
| InChIKey | PEKCIQTUBREDET-RBUKOAKNSA-N |
| XLogP | 2.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |