About 2-octyl-1,2-thiazolidin-4-one;hydrochloride
2-octyl-1,2-thiazolidin-4-one;hydrochloride (PubChem CID 141119725) has the molecular formula C11H22ClNOS
and a molecular weight of 251.82 g/mol. Its IUPAC name is 2-octyl-1,2-thiazolidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-octyl-1,2-thiazolidin-4-one;hydrochloride |
| PubChem CID | 141119725 |
| Molecular Formula | C11H22ClNOS |
| Molecular Weight | 251.82 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-octyl-1,2-thiazolidin-4-one;hydrochloride |
| SMILES | CCCCCCCCN1CC(=O)CS1.Cl |
| InChI | InChI=1S/C11H21NOS.ClH/c1-2-3-4-5-6-7-8-12-9-11(13)10-14-12;/h2-10H2,1H3;1H |
| InChIKey | QAHFWEDUHHURQK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-octyl-1,2-thiazolidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyl-1,2-thiazolidin-4-one;hydrochloride?
The IUPAC name of 2-octyl-1,2-thiazolidin-4-one;hydrochloride (CID 141119725) is 2-octyl-1,2-thiazolidin-4-one;hydrochloride.
What is the SMILES notation for 2-octyl-1,2-thiazolidin-4-one;hydrochloride?
The canonical SMILES for 2-octyl-1,2-thiazolidin-4-one;hydrochloride is CCCCCCCCN1CC(=O)CS1.Cl.
What is the InChIKey of 2-octyl-1,2-thiazolidin-4-one;hydrochloride?
The InChIKey is QAHFWEDUHHURQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NOS.ClH/c1-2-3-4-5-6-7-8-12-9-11(13)10-14-12;/h2-10H2,1H3;1H.
What are the key properties of 2-octyl-1,2-thiazolidin-4-one;hydrochloride?
2-octyl-1,2-thiazolidin-4-one;hydrochloride has a molecular weight of 251.82 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyl-1,2-thiazolidin-4-one;hydrochloride is sourced from PubChem (CID 141119725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).