C11H21Cl2NS — CID 19063314
4,5-dichloro-2-octyl-1,2-thiazolidine (PubChem CID 19063314) has the molecular formula C11H21Cl2NS and a molecular weight of 270.27 g/mol. Its IUPAC name is 4,5-dichloro-2-octyl-1,2-thiazolidine.
| Compound Name | 4,5-dichloro-2-octyl-1,2-thiazolidine |
|---|---|
| PubChem CID | 19063314 |
| Molecular Formula | C11H21Cl2NS |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4,5-dichloro-2-octyl-1,2-thiazolidine |
| SMILES | CCCCCCCCN1CC(Cl)C(Cl)S1 |
| InChI | InChI=1S/C11H21Cl2NS/c1-2-3-4-5-6-7-8-14-9-10(12)11(13)15-14/h10-11H,2-9H2,1H3 |
| InChIKey | JTPICTYDXYAVTH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|