C24H28ClN5S — CID 141121467
2-[4-[4-(6-chloro-3-methyl-2H-quinazolin-2-yl)butyl]piperazin-1-yl]-1,3-benzothiazole (PubChem CID 141121467) has the molecular formula C24H28ClN5S and a molecular weight of 454.04 g/mol. Its IUPAC name is 2-[4-[4-(6-chloro-3-methyl-2H-quinazolin-2-yl)butyl]piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-[4-(6-chloro-3-methyl-2H-quinazolin-2-yl)butyl]piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 141121467 |
| Molecular Formula | C24H28ClN5S |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[4-[4-(6-chloro-3-methyl-2H-quinazolin-2-yl)butyl]piperazin-1-yl]-1,3-benzothiazole |
| SMILES | CN1C=c2cc(Cl)ccc2=NC1CCCCN1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C24H28ClN5S/c1-28-17-18-16-19(25)9-10-20(18)26-23(28)8-4-5-11-29-12-14-30(15-13-29)24-27-21-6-2-3-7-22(21)31-24/h2-3,6-7,9-10,16-17,23H,4-5,8,11-15H2,1H3 |
| InChIKey | DWXIKSJJPAMFGW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|