C18H17NO3S — CID 141121811
2-[4-(4-methylsulfonylphenoxy)cyclohexa-2,4-dien-1-yl]pyridine (PubChem CID 141121811) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[4-(4-methylsulfonylphenoxy)cyclohexa-2,4-dien-1-yl]pyridine.
| Compound Name | 2-[4-(4-methylsulfonylphenoxy)cyclohexa-2,4-dien-1-yl]pyridine |
|---|---|
| PubChem CID | 141121811 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[4-(4-methylsulfonylphenoxy)cyclohexa-2,4-dien-1-yl]pyridine |
| SMILES | CS(=O)(=O)c1ccc(OC2=CCC(c3ccccn3)C=C2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-23(20,21)17-11-9-16(10-12-17)22-15-7-5-14(6-8-15)18-4-2-3-13-19-18/h2-5,7-14H,6H2,1H3 |
| InChIKey | JCEFDEXGJIKVML-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |