C7H14O6S — CID 141123583
S-methyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate (PubChem CID 141123583) has the molecular formula C7H14O6S and a molecular weight of 226.25 g/mol. Its IUPAC name is S-methyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate.
| Compound Name | S-methyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
|---|---|
| PubChem CID | 141123583 |
| Molecular Formula | C7H14O6S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | S-methyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
| SMILES | CSC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O6S/c1-14-7(13)6(12)5(11)4(10)3(9)2-8/h3-6,8-12H,2H2,1H3/t3-,4-,5+,6-/m1/s1 |
| InChIKey | FZHDGDRIJIQUFL-ARQDHWQXSA-N |
| XLogP | -2.69 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|