C13H12N6O4 — CID 141131506
6-[2-(1H-imidazol-5-yl)ethylamino]-7-nitro-1H-quinazoline-2,4-dione (PubChem CID 141131506) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is 6-[2-(1H-imidazol-5-yl)ethylamino]-7-nitro-1H-quinazoline-2,4-dione.
| Compound Name | 6-[2-(1H-imidazol-5-yl)ethylamino]-7-nitro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 141131506 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 6-[2-(1H-imidazol-5-yl)ethylamino]-7-nitro-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(NCCc3cnc[nH]3)c([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C13H12N6O4/c20-12-8-3-10(15-2-1-7-5-14-6-16-7)11(19(22)23)4-9(8)17-13(21)18-12/h3-6,15H,1-2H2,(H,14,16)(H2,17,18,20,21) |
| InChIKey | RCJVGFUJMBYTFU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|