C15H15F5O5S3 — CID 141135700
methyl 4-(5-methyl-2-methylsulfonylphenoxy)-2-(pentafluoro-λ6-sulfanyl)benzenesulfinate (PubChem CID 141135700) has the molecular formula C15H15F5O5S3 and a molecular weight of 466.47 g/mol. Its IUPAC name is methyl 4-(5-methyl-2-methylsulfonylphenoxy)-2-(pentafluoro-λ6-sulfanyl)benzenesulfinate.
| Compound Name | methyl 4-(5-methyl-2-methylsulfonylphenoxy)-2-(pentafluoro-λ6-sulfanyl)benzenesulfinate |
|---|---|
| PubChem CID | 141135700 |
| Molecular Formula | C15H15F5O5S3 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | methyl 4-(5-methyl-2-methylsulfonylphenoxy)-2-(pentafluoro-λ6-sulfanyl)benzenesulfinate |
| SMILES | COS(=O)c1ccc(Oc2cc(C)ccc2S(C)(=O)=O)cc1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C15H15F5O5S3/c1-10-4-7-14(27(3,22)23)12(8-10)25-11-5-6-13(26(21)24-2)15(9-11)28(16,17,18,19)20/h4-9H,1-3H3 |
| InChIKey | WXGZMZDMCYYCBJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |