C8H8N2S — CID 141136079
1-methyl-6H-pyrrolo[2,3-c]pyridine-5-thione (PubChem CID 141136079) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 1-methyl-6H-pyrrolo[2,3-c]pyridine-5-thione.
| Compound Name | 1-methyl-6H-pyrrolo[2,3-c]pyridine-5-thione |
|---|---|
| PubChem CID | 141136079 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 1-methyl-6H-pyrrolo[2,3-c]pyridine-5-thione |
| SMILES | Cn1ccc2cc(=S)[nH]cc21 |
| InChI | InChI=1S/C8H8N2S/c1-10-3-2-6-4-8(11)9-5-7(6)10/h2-5H,1H3,(H,9,11) |
| InChIKey | WBDOSGUPOMHTOB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|