C23H28ClN3O3 — CID 141137554
octyl 3-[2-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate (PubChem CID 141137554) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is octyl 3-[2-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate.
| Compound Name | octyl 3-[2-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 141137554 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | octyl 3-[2-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1ccc(O)cc1-n1nc2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C23H28ClN3O3/c1-2-3-4-5-6-7-14-30-23(29)13-9-17-8-11-19(28)16-22(17)27-25-20-12-10-18(24)15-21(20)26-27/h8,10-12,15-16,28H,2-7,9,13-14H2,1H3 |
| InChIKey | JTBIOAKSGOWWOS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|